C39H33N3O3 — CID 101098774
4-(N-[4-[(E)-2-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]ethenyl]phenyl]anilino)benzoic acid (PubChem CID 101098774) has the molecular formula C39H33N3O3 and a molecular weight of 591.71 g/mol. Its IUPAC name is 4-(N-[4-[(E)-2-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]ethenyl]phenyl]anilino)benzoic acid.
| Compound Name | 4-(N-[4-[(E)-2-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]ethenyl]phenyl]anilino)benzoic acid |
|---|---|
| PubChem CID | 101098774 |
| Molecular Formula | C39H33N3O3 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | 4-(N-[4-[(E)-2-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]ethenyl]phenyl]anilino)benzoic acid |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3ccc(/C=C/c4ccc(N(c5ccccc5)c5ccc(C(=O)O)cc5)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C39H33N3O3/c1-39(2,3)32-21-17-30(18-22-32)37-41-40-36(45-37)29-15-11-27(12-16-29)9-10-28-13-23-34(24-14-28)42(33-7-5-4-6-8-33)35-25-19-31(20-26-35)38(43)44/h4-26H,1-3H3,(H,43,44)/b10-9+ |
| InChIKey | BVQRMUXZVISVHA-MDZDMXLPSA-N |
| XLogP | 10.04 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|