C89H85N7 — CID 76695562
N,N-bis[4-[2-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]ethenyl]phenyl]-4-[2-(4-methylphenyl)ethenyl]aniline (PubChem CID 76695562) has the molecular formula C89H85N7 and a molecular weight of 1252.71 g/mol. Its IUPAC name is N,N-bis[4-[2-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]ethenyl]phenyl]-4-[2-(4-methylphenyl)ethenyl]aniline.
| Compound Name | N,N-bis[4-[2-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]ethenyl]phenyl]-4-[2-(4-methylphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 76695562 |
| Molecular Formula | C89H85N7 |
| Molecular Weight | 1252.71 g/mol |
| Exact Mass | 1251.69 |
| IUPAC Name | N,N-bis[4-[2-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]ethenyl]phenyl]-4-[2-(4-methylphenyl)ethenyl]aniline |
| SMILES | Cc1ccc(C=Cc2ccc(N(c3ccc(C=Cc4ccc(-c5nc(-c6ccc(C(C)(C)C)cc6)nc(-c6ccc(C(C)(C)C)cc6)n5)cc4)cc3)c3ccc(C=Cc4ccc(-c5nc(-c6ccc(C(C)(C)C)cc6)nc(-c6ccc(C(C)(C)C)cc6)n5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C89H85N7/c1-60-14-16-61(17-15-60)18-21-64-28-54-77(55-29-64)96(78-56-30-65(31-57-78)22-19-62-24-34-67(35-25-62)80-90-82(69-38-46-73(47-39-69)86(2,3)4)94-83(91-80)70-40-48-74(49-41-70)87(5,6)7)79-58-32-66(33-59-79)23-20-63-26-36-68(37-27-63)81-92-84(71-42-50-75(51-43-71)88(8,9)10)95-85(93-81)72-44-52-76(53-45-72)89(11,12)13/h14-59H,1-13H3 |
| InChIKey | QPSPXXMIZSBOSS-UHFFFAOYSA-N |
| XLogP | 23.54 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1252.71 |
| LogP ≤ 5 | 23.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|