C55H41N5O — CID 177431422
4,6-bis[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-ol (PubChem CID 177431422) has the molecular formula C55H41N5O and a molecular weight of 787.97 g/mol. Its IUPAC name is 4,6-bis[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-ol.
| Compound Name | 4,6-bis[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-ol |
|---|---|
| PubChem CID | 177431422 |
| Molecular Formula | C55H41N5O |
| Molecular Weight | 787.97 g/mol |
| Exact Mass | 787.33 |
| IUPAC Name | 4,6-bis[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-ol |
| SMILES | Oc1nc(-c2ccc(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)nc(-c2ccc(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C55H41N5O/c61-55-57-53(45-33-25-41(26-34-45)21-23-43-29-37-51(38-30-43)59(47-13-5-1-6-14-47)48-15-7-2-8-16-48)56-54(58-55)46-35-27-42(28-36-46)22-24-44-31-39-52(40-32-44)60(49-17-9-3-10-18-49)50-19-11-4-12-20-50/h1-40H,(H,56,57,58,61)/b23-21+,24-22+ |
| InChIKey | VDHQLPALAYZUQI-MBALSZOMSA-N |
| XLogP | 14.19 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.97 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|