C16H22N2 — CID 146577623
(3Z)-N,3-dimethyl-5-methylimino-6-(2-methylphenyl)hexa-1,3-dien-2-amine (PubChem CID 146577623) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (3Z)-N,3-dimethyl-5-methylimino-6-(2-methylphenyl)hexa-1,3-dien-2-amine.
| Compound Name | (3Z)-N,3-dimethyl-5-methylimino-6-(2-methylphenyl)hexa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 146577623 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (3Z)-N,3-dimethyl-5-methylimino-6-(2-methylphenyl)hexa-1,3-dien-2-amine |
| SMILES | C=C(NC)/C(C)=C\C(Cc1ccccc1C)=N/C |
| InChI | InChI=1S/C16H22N2/c1-12-8-6-7-9-15(12)11-16(18-5)10-13(2)14(3)17-4/h6-10,17H,3,11H2,1-2,4-5H3/b13-10-,18-16+ |
| InChIKey | YVCQBCGODIJYJB-GCRZPWQESA-N |
| XLogP | 3.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|