C6H12N2 — CID 170084876
1-N-ethenyl-2-N-methylprop-2-ene-1,2-diamine (PubChem CID 170084876) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1-N-ethenyl-2-N-methylprop-2-ene-1,2-diamine.
| Compound Name | 1-N-ethenyl-2-N-methylprop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 170084876 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1-N-ethenyl-2-N-methylprop-2-ene-1,2-diamine |
| SMILES | C=CNCC(=C)NC |
| InChI | InChI=1S/C6H12N2/c1-4-8-5-6(2)7-3/h4,7-8H,1-2,5H2,3H3 |
| InChIKey | JJSFWWKUZDFKPV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |