C9H17N — CID 155584945
N,5-dimethylhepta-1,6-dien-2-amine (PubChem CID 155584945) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is N,5-dimethylhepta-1,6-dien-2-amine.
| Compound Name | N,5-dimethylhepta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 155584945 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N,5-dimethylhepta-1,6-dien-2-amine |
| SMILES | C=CC(C)CCC(=C)NC |
| InChI | InChI=1S/C9H17N/c1-5-8(2)6-7-9(3)10-4/h5,8,10H,1,3,6-7H2,2,4H3 |
| InChIKey | IYQMLBJEZKOEMN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|