C14H25N — CID 130462131
1-[(2E)-3,6-dimethylocta-2,7-dienyl]pyrrolidine (PubChem CID 130462131) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 1-[(2E)-3,6-dimethylocta-2,7-dienyl]pyrrolidine.
| Compound Name | 1-[(2E)-3,6-dimethylocta-2,7-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 130462131 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-[(2E)-3,6-dimethylocta-2,7-dienyl]pyrrolidine |
| SMILES | C=CC(C)CC/C(C)=C/CN1CCCC1 |
| InChI | InChI=1S/C14H25N/c1-4-13(2)7-8-14(3)9-12-15-10-5-6-11-15/h4,9,13H,1,5-8,10-12H2,2-3H3/b14-9+ |
| InChIKey | XNLNAKXSOJDREB-NTEUORMPSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|