C13H19NO — CID 142857928
(3Z,5E)-5-ethylidene-8-methyl-6-methyliminonona-3,7-dienal (PubChem CID 142857928) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (3Z,5E)-5-ethylidene-8-methyl-6-methyliminonona-3,7-dienal.
| Compound Name | (3Z,5E)-5-ethylidene-8-methyl-6-methyliminonona-3,7-dienal |
|---|---|
| PubChem CID | 142857928 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (3Z,5E)-5-ethylidene-8-methyl-6-methyliminonona-3,7-dienal |
| SMILES | C/C=C(\C=C/CC=O)C(/C=C(C)C)=N/C |
| InChI | InChI=1S/C13H19NO/c1-5-12(8-6-7-9-15)13(14-4)10-11(2)3/h5-6,8-10H,7H2,1-4H3/b8-6-,12-5+,14-13+ |
| InChIKey | FIYIPPBVUBWKKD-XNJJZIGVSA-N |
| XLogP | 3.11 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|