C15H24 — CID 144520293
(4E,5E,6E)-4,5-di(ethylidene)-2,7-dimethylnona-2,6-diene (PubChem CID 144520293) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (4E,5E,6E)-4,5-di(ethylidene)-2,7-dimethylnona-2,6-diene.
| Compound Name | (4E,5E,6E)-4,5-di(ethylidene)-2,7-dimethylnona-2,6-diene |
|---|---|
| PubChem CID | 144520293 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (4E,5E,6E)-4,5-di(ethylidene)-2,7-dimethylnona-2,6-diene |
| SMILES | C/C=C(C=C(C)C)/C(/C=C(\C)CC)=C/C |
| InChI | InChI=1S/C15H24/c1-7-13(6)11-15(9-3)14(8-2)10-12(4)5/h8-11H,7H2,1-6H3/b13-11+,14-8+,15-9+ |
| InChIKey | IJVJZVMMEGYQKD-UZXDVRJKSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|