C17H30 — CID 143893546
ethane;(4E,6Z)-2,4,7-trimethyl-5-[(Z)-prop-1-enyl]nona-2,4,6-triene (PubChem CID 143893546) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is ethane;(4E,6Z)-2,4,7-trimethyl-5-[(Z)-prop-1-enyl]nona-2,4,6-triene.
| Compound Name | ethane;(4E,6Z)-2,4,7-trimethyl-5-[(Z)-prop-1-enyl]nona-2,4,6-triene |
|---|---|
| PubChem CID | 143893546 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | ethane;(4E,6Z)-2,4,7-trimethyl-5-[(Z)-prop-1-enyl]nona-2,4,6-triene |
| SMILES | C/C=C\C(\C=C(\C)CC)=C(\C)C=C(C)C.CC |
| InChI | InChI=1S/C15H24.C2H6/c1-7-9-15(11-13(5)8-2)14(6)10-12(3)4;1-2/h7,9-11H,8H2,1-6H3;1-2H3/b9-7-,13-11-,15-14+; |
| InChIKey | CTZWYCKASKQMKK-JKNLZCCESA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|