C17H25N3 — CID 143316652
3-methyl-4-(methylaminomethyl)-N-(5-methyl-3-methyliminohexa-1,4-dien-2-yl)aniline (PubChem CID 143316652) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 3-methyl-4-(methylaminomethyl)-N-(5-methyl-3-methyliminohexa-1,4-dien-2-yl)aniline.
| Compound Name | 3-methyl-4-(methylaminomethyl)-N-(5-methyl-3-methyliminohexa-1,4-dien-2-yl)aniline |
|---|---|
| PubChem CID | 143316652 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 3-methyl-4-(methylaminomethyl)-N-(5-methyl-3-methyliminohexa-1,4-dien-2-yl)aniline |
| SMILES | C=C(Nc1ccc(CNC)c(C)c1)/C(C=C(C)C)=N/C |
| InChI | InChI=1S/C17H25N3/c1-12(2)9-17(19-6)14(4)20-16-8-7-15(11-18-5)13(3)10-16/h7-10,18,20H,4,11H2,1-3,5-6H3/b19-17+ |
| InChIKey | JDBQMLSGGPNZBE-HTXNQAPBSA-N |
| XLogP | 3.68 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|