C11H18N2 — CID 62135688
N,N,3-trimethyl-4-(methylaminomethyl)aniline (PubChem CID 62135688) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N,N,3-trimethyl-4-(methylaminomethyl)aniline.
| Compound Name | N,N,3-trimethyl-4-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 62135688 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N,N,3-trimethyl-4-(methylaminomethyl)aniline |
| SMILES | CNCc1ccc(N(C)C)cc1C |
| InChI | InChI=1S/C11H18N2/c1-9-7-11(13(3)4)6-5-10(9)8-12-2/h5-7,12H,8H2,1-4H3 |
| InChIKey | VHZUALAYPGLIBE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|