C18H23N — CID 58536659
4-[(2,4-dimethylphenyl)methyl]-N,N,3-trimethylaniline (PubChem CID 58536659) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenyl)methyl]-N,N,3-trimethylaniline.
| Compound Name | 4-[(2,4-dimethylphenyl)methyl]-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 58536659 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 4-[(2,4-dimethylphenyl)methyl]-N,N,3-trimethylaniline |
| SMILES | Cc1ccc(Cc2ccc(N(C)C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H23N/c1-13-6-7-16(14(2)10-13)12-17-8-9-18(19(4)5)11-15(17)3/h6-11H,12H2,1-5H3 |
| InChIKey | QHYKVYVRNDHUQS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|