About 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline
4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline (PubChem CID 84750842) has the molecular formula C10H15FN2
and a molecular weight of 182.24 g/mol. Its IUPAC name is 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline.
Molecular Properties
| Compound Name | 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline |
| PubChem CID | 84750842 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline |
| SMILES | CNCc1cc(N(C)C)ccc1F |
| InChI | InChI=1S/C10H15FN2/c1-12-7-8-6-9(13(2)3)4-5-10(8)11/h4-6,12H,7H2,1-3H3 |
| InChIKey | CGIUUTANJULGLE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline?
The IUPAC name of 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline (CID 84750842) is 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline.
What is the SMILES notation for 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline?
The canonical SMILES for 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline is CNCc1cc(N(C)C)ccc1F.
What is the InChIKey of 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline?
The InChIKey is CGIUUTANJULGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2/c1-12-7-8-6-9(13(2)3)4-5-10(8)11/h4-6,12H,7H2,1-3H3.
What are the key properties of 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline?
4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline has a molecular weight of 182.24 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline is sourced from PubChem (CID 84750842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).