C10H15FN2 — CID 84750842
4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline (PubChem CID 84750842) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline.
| Compound Name | 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 84750842 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4-fluoro-N,N-dimethyl-3-(methylaminomethyl)aniline |
| SMILES | CNCc1cc(N(C)C)ccc1F |
| InChI | InChI=1S/C10H15FN2/c1-12-7-8-6-9(13(2)3)4-5-10(8)11/h4-6,12H,7H2,1-3H3 |
| InChIKey | CGIUUTANJULGLE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |