About difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine
difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine (PubChem CID 145244546) has the molecular formula C13H20F3N
and a molecular weight of 247.30 g/mol. Its IUPAC name is difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine.
Molecular Properties
| Compound Name | difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine |
| PubChem CID | 145244546 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine |
| SMILES | C=Cc1ccc(F)c(CNC)c1.CC.FCF |
| InChI | InChI=1S/C10H12FN.C2H6.CH2F2/c1-3-8-4-5-10(11)9(6-8)7-12-2;1-2;2-1-3/h3-6,12H,1,7H2,2H3;1-2H3;1H2 |
| InChIKey | XNGXOBVGWYIYMQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine?
The IUPAC name of difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine (CID 145244546) is difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine.
What is the SMILES notation for difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine?
The canonical SMILES for difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine is C=Cc1ccc(F)c(CNC)c1.CC.FCF.
What is the InChIKey of difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine?
The InChIKey is XNGXOBVGWYIYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN.C2H6.CH2F2/c1-3-8-4-5-10(11)9(6-8)7-12-2;1-2;2-1-3/h3-6,12H,1,7H2,2H3;1-2H3;1H2.
What are the key properties of difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine?
difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine has a molecular weight of 247.30 g/mol, XLogP of 4.10, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethane;ethane;1-(5-ethenyl-2-fluorophenyl)-N-methylmethanamine is sourced from PubChem (CID 145244546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).