C19H29N3 — CID 174067089
3-amino-N',4,4-trimethyl-N-[3-methyl-4-(2-methylprop-2-enyl)phenyl]pent-2-enimidamide (PubChem CID 174067089) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 3-amino-N',4,4-trimethyl-N-[3-methyl-4-(2-methylprop-2-enyl)phenyl]pent-2-enimidamide.
| Compound Name | 3-amino-N',4,4-trimethyl-N-[3-methyl-4-(2-methylprop-2-enyl)phenyl]pent-2-enimidamide |
|---|---|
| PubChem CID | 174067089 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 3-amino-N',4,4-trimethyl-N-[3-methyl-4-(2-methylprop-2-enyl)phenyl]pent-2-enimidamide |
| SMILES | C=C(C)Cc1ccc(N/C(C=C(N)C(C)(C)C)=N\C)cc1C |
| InChI | InChI=1S/C19H29N3/c1-13(2)10-15-8-9-16(11-14(15)3)22-18(21-7)12-17(20)19(4,5)6/h8-9,11-12H,1,10,20H2,2-7H3,(H,21,22) |
| InChIKey | PHCVKYSQECXMLV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|