C19H22N4O2 — CID 129015180
(Z)-N-(4-amino-3-methoxyphenyl)-3-(2-methoxyphenyl)-N'-methyl-3-(methylideneamino)prop-2-enimidamide (PubChem CID 129015180) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (Z)-N-(4-amino-3-methoxyphenyl)-3-(2-methoxyphenyl)-N'-methyl-3-(methylideneamino)prop-2-enimidamide.
| Compound Name | (Z)-N-(4-amino-3-methoxyphenyl)-3-(2-methoxyphenyl)-N'-methyl-3-(methylideneamino)prop-2-enimidamide |
|---|---|
| PubChem CID | 129015180 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (Z)-N-(4-amino-3-methoxyphenyl)-3-(2-methoxyphenyl)-N'-methyl-3-(methylideneamino)prop-2-enimidamide |
| SMILES | C=N/C(=C\C(=N/C)Nc1ccc(N)c(OC)c1)c1ccccc1OC |
| InChI | InChI=1S/C19H22N4O2/c1-21-16(14-7-5-6-8-17(14)24-3)12-19(22-2)23-13-9-10-15(20)18(11-13)25-4/h5-12H,1,20H2,2-4H3,(H,22,23)/b16-12- |
| InChIKey | QUZCQAGCQXVNAW-VBKFSLOCSA-N |
| XLogP | 3.47 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|