C20H20F2N4O3 — CID 129015231
N-[5-[[C-[(Z)-2-(4,5-difluoro-2-methoxyphenyl)-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]amino]-2-methoxyphenyl]formamide (PubChem CID 129015231) has the molecular formula C20H20F2N4O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is N-[5-[[C-[(Z)-2-(4,5-difluoro-2-methoxyphenyl)-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]amino]-2-methoxyphenyl]formamide.
| Compound Name | N-[5-[[C-[(Z)-2-(4,5-difluoro-2-methoxyphenyl)-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]amino]-2-methoxyphenyl]formamide |
|---|---|
| PubChem CID | 129015231 |
| Molecular Formula | C20H20F2N4O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[5-[[C-[(Z)-2-(4,5-difluoro-2-methoxyphenyl)-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]amino]-2-methoxyphenyl]formamide |
| SMILES | C=N/C(=C\C(=N\C)Nc1ccc(OC)c(NC=O)c1)c1cc(F)c(F)cc1OC |
| InChI | InChI=1S/C20H20F2N4O3/c1-23-16(13-8-14(21)15(22)9-19(13)29-4)10-20(24-2)26-12-5-6-18(28-3)17(7-12)25-11-27/h5-11H,1H2,2-4H3,(H,24,26)(H,25,27)/b16-10- |
| InChIKey | IEQWLWNIBFFOIU-YBEGLDIGSA-N |
| XLogP | 3.73 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|