C7H12FN — CID 89153786
(5Z)-2-fluorohepta-1,5-dien-3-amine (PubChem CID 89153786) has the molecular formula C7H12FN and a molecular weight of 129.18 g/mol. Its IUPAC name is (5Z)-2-fluorohepta-1,5-dien-3-amine.
| Compound Name | (5Z)-2-fluorohepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 89153786 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (5Z)-2-fluorohepta-1,5-dien-3-amine |
| SMILES | C=C(F)C(N)C/C=C\C |
| InChI | InChI=1S/C7H12FN/c1-3-4-5-7(9)6(2)8/h3-4,7H,2,5,9H2,1H3/b4-3- |
| InChIKey | YODXZYPWZJPFOB-ARJAWSKDSA-N |
| XLogP | 1.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|