About (Z)-1-aminohex-4-en-2-ol
(Z)-1-aminohex-4-en-2-ol (PubChem CID 155394876) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is (Z)-1-aminohex-4-en-2-ol.
Molecular Properties
| Compound Name | (Z)-1-aminohex-4-en-2-ol |
| PubChem CID | 155394876 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | (Z)-1-aminohex-4-en-2-ol |
| SMILES | C/C=C\CC(O)CN |
| InChI | InChI=1S/C6H13NO/c1-2-3-4-6(8)5-7/h2-3,6,8H,4-5,7H2,1H3/b3-2- |
| InChIKey | XHBZBJKAHIUMLC-IHWYPQMZSA-N |
| XLogP | 0.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-aminohex-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-aminohex-4-en-2-ol?
The IUPAC name of (Z)-1-aminohex-4-en-2-ol (CID 155394876) is (Z)-1-aminohex-4-en-2-ol.
What is the SMILES notation for (Z)-1-aminohex-4-en-2-ol?
The canonical SMILES for (Z)-1-aminohex-4-en-2-ol is C/C=C\CC(O)CN.
What is the InChIKey of (Z)-1-aminohex-4-en-2-ol?
The InChIKey is XHBZBJKAHIUMLC-IHWYPQMZSA-N. The full InChI is InChI=1S/C6H13NO/c1-2-3-4-6(8)5-7/h2-3,6,8H,4-5,7H2,1H3/b3-2-.
What are the key properties of (Z)-1-aminohex-4-en-2-ol?
(Z)-1-aminohex-4-en-2-ol has a molecular weight of 115.18 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-aminohex-4-en-2-ol is sourced from PubChem (CID 155394876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).