C11H22N2 — CID 167096899
2,4-dimethylnona-1,7-dien-5-ylhydrazine (PubChem CID 167096899) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2,4-dimethylnona-1,7-dien-5-ylhydrazine.
| Compound Name | 2,4-dimethylnona-1,7-dien-5-ylhydrazine |
|---|---|
| PubChem CID | 167096899 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2,4-dimethylnona-1,7-dien-5-ylhydrazine |
| SMILES | C=C(C)CC(C)C(CC=CC)NN |
| InChI | InChI=1S/C11H22N2/c1-5-6-7-11(13-12)10(4)8-9(2)3/h5-6,10-11,13H,2,7-8,12H2,1,3-4H3 |
| InChIKey | JAKOMSPRBNKJBG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|