C10H19N — CID 174019086
(2E,3S)-2-ethylidene-3,5-dimethylhex-5-en-1-amine (PubChem CID 174019086) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (2E,3S)-2-ethylidene-3,5-dimethylhex-5-en-1-amine.
| Compound Name | (2E,3S)-2-ethylidene-3,5-dimethylhex-5-en-1-amine |
|---|---|
| PubChem CID | 174019086 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (2E,3S)-2-ethylidene-3,5-dimethylhex-5-en-1-amine |
| SMILES | C=C(C)C[C@H](C)/C(=C\C)CN |
| InChI | InChI=1S/C10H19N/c1-5-10(7-11)9(4)6-8(2)3/h5,9H,2,6-7,11H2,1,3-4H3/b10-5-/t9-/m0/s1 |
| InChIKey | LCFXAICXMJBNRF-QFQXNISHSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|