C12H20 — CID 145367319
(6E)-2,4,6-trimethyl-3-methylideneocta-1,6-diene (PubChem CID 145367319) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (6E)-2,4,6-trimethyl-3-methylideneocta-1,6-diene.
| Compound Name | (6E)-2,4,6-trimethyl-3-methylideneocta-1,6-diene |
|---|---|
| PubChem CID | 145367319 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (6E)-2,4,6-trimethyl-3-methylideneocta-1,6-diene |
| SMILES | C=C(C)C(=C)C(C)C/C(C)=C/C |
| InChI | InChI=1S/C12H20/c1-7-10(4)8-11(5)12(6)9(2)3/h7,11H,2,6,8H2,1,3-5H3/b10-7+ |
| InChIKey | WRIVNCCZMYAPHW-JXMROGBWSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|