C10H17NO2 — CID 155362173
(Z)-N-hydroxy-3,5-dimethyl-2-methylidenehept-5-enamide (PubChem CID 155362173) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (Z)-N-hydroxy-3,5-dimethyl-2-methylidenehept-5-enamide.
| Compound Name | (Z)-N-hydroxy-3,5-dimethyl-2-methylidenehept-5-enamide |
|---|---|
| PubChem CID | 155362173 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (Z)-N-hydroxy-3,5-dimethyl-2-methylidenehept-5-enamide |
| SMILES | C=C(C(=O)NO)C(C)C/C(C)=C\C |
| InChI | InChI=1S/C10H17NO2/c1-5-7(2)6-8(3)9(4)10(12)11-13/h5,8,13H,4,6H2,1-3H3,(H,11,12)/b7-5- |
| InChIKey | YXCKOXKMPDETSE-ALCCZGGFSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|