C10H15NO2 — CID 156751161
N-[(E,2S)-4-methyl-1-oxohex-4-en-2-yl]prop-2-enamide (PubChem CID 156751161) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[(E,2S)-4-methyl-1-oxohex-4-en-2-yl]prop-2-enamide.
| Compound Name | N-[(E,2S)-4-methyl-1-oxohex-4-en-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 156751161 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[(E,2S)-4-methyl-1-oxohex-4-en-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H](C=O)C/C(C)=C/C |
| InChI | InChI=1S/C10H15NO2/c1-4-8(3)6-9(7-12)11-10(13)5-2/h4-5,7,9H,2,6H2,1,3H3,(H,11,13)/b8-4+/t9-/m0/s1 |
| InChIKey | QKAFEWKFDWISPE-SGDMMICCSA-N |
| XLogP | 1.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|