C9H13N — CID 163623672
(2Z,4Z)-6-methylideneocta-2,4,7-trien-1-amine (PubChem CID 163623672) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (2Z,4Z)-6-methylideneocta-2,4,7-trien-1-amine.
| Compound Name | (2Z,4Z)-6-methylideneocta-2,4,7-trien-1-amine |
|---|---|
| PubChem CID | 163623672 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (2Z,4Z)-6-methylideneocta-2,4,7-trien-1-amine |
| SMILES | C=CC(=C)/C=C\C=C/CN |
| InChI | InChI=1S/C9H13N/c1-3-9(2)7-5-4-6-8-10/h3-7H,1-2,8,10H2/b6-4-,7-5- |
| InChIKey | HQGXTYLFZVOMSS-PEPZGXQESA-N |
| XLogP | 1.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|