C9H10F2 — CID 138723097
(4E,6E)-5,7-difluoro-3-methylideneocta-1,4,6-triene (PubChem CID 138723097) has the molecular formula C9H10F2 and a molecular weight of 156.17 g/mol. Its IUPAC name is (4E,6E)-5,7-difluoro-3-methylideneocta-1,4,6-triene.
| Compound Name | (4E,6E)-5,7-difluoro-3-methylideneocta-1,4,6-triene |
|---|---|
| PubChem CID | 138723097 |
| Molecular Formula | C9H10F2 |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (4E,6E)-5,7-difluoro-3-methylideneocta-1,4,6-triene |
| SMILES | C=CC(=C)/C=C(F)\C=C(/C)F |
| InChI | InChI=1S/C9H10F2/c1-4-7(2)5-9(11)6-8(3)10/h4-6H,1-2H2,3H3/b8-6+,9-5+ |
| InChIKey | DRIBFKKKGORSHY-RFSWUZDDSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|