C9H12F2S — CID 131989191
(4E)-5-fluoro-3-(1-fluoroethenylsulfanyl)-2-methylhexa-2,4-diene (PubChem CID 131989191) has the molecular formula C9H12F2S and a molecular weight of 190.26 g/mol. Its IUPAC name is (4E)-5-fluoro-3-(1-fluoroethenylsulfanyl)-2-methylhexa-2,4-diene.
| Compound Name | (4E)-5-fluoro-3-(1-fluoroethenylsulfanyl)-2-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 131989191 |
| Molecular Formula | C9H12F2S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (4E)-5-fluoro-3-(1-fluoroethenylsulfanyl)-2-methylhexa-2,4-diene |
| SMILES | C=C(F)SC(/C=C(\C)F)=C(C)C |
| InChI | InChI=1S/C9H12F2S/c1-6(2)9(5-7(3)10)12-8(4)11/h5H,4H2,1-3H3/b7-5+ |
| InChIKey | PBIXBQZEAZIJMX-FNORWQNLSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|