C12H13F — CID 131995426
[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]benzene (PubChem CID 131995426) has the molecular formula C12H13F and a molecular weight of 176.23 g/mol. Its IUPAC name is [(2E,4E)-5-fluorohexa-2,4-dien-3-yl]benzene.
| Compound Name | [(2E,4E)-5-fluorohexa-2,4-dien-3-yl]benzene |
|---|---|
| PubChem CID | 131995426 |
| Molecular Formula | C12H13F |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | [(2E,4E)-5-fluorohexa-2,4-dien-3-yl]benzene |
| SMILES | C/C=C(\C=C(/C)F)c1ccccc1 |
| InChI | InChI=1S/C12H13F/c1-3-11(9-10(2)13)12-7-5-4-6-8-12/h3-9H,1-2H3/b10-9+,11-3+ |
| InChIKey | GEOFWSXTBXSSSI-VVVHQUFHSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|