About methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane
methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane (PubChem CID 163826949) has the molecular formula C13H15P
and a molecular weight of 202.24 g/mol. Its IUPAC name is methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane.
Molecular Properties
| Compound Name | methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane |
| PubChem CID | 163826949 |
| Molecular Formula | C13H15P |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane |
| SMILES | C=P/C(C)=C/C(=C\C)c1ccccc1 |
| InChI | InChI=1S/C13H15P/c1-4-12(10-11(2)14-3)13-8-6-5-7-9-13/h4-10H,3H2,1-2H3/b11-10+,12-4+ |
| InChIKey | OAHJBGXFXQBHMH-QNKFPFBSSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane?
The IUPAC name of methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane (CID 163826949) is methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane.
What is the SMILES notation for methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane?
The canonical SMILES for methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane is C=P/C(C)=C/C(=C\C)c1ccccc1.
What is the InChIKey of methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane?
The InChIKey is OAHJBGXFXQBHMH-QNKFPFBSSA-N. The full InChI is InChI=1S/C13H15P/c1-4-12(10-11(2)14-3)13-8-6-5-7-9-13/h4-10H,3H2,1-2H3/b11-10+,12-4+.
What are the key properties of methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane?
methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane has a molecular weight of 202.24 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane is sourced from PubChem (CID 163826949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).