C13H15P — CID 163826949
methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane (PubChem CID 163826949) has the molecular formula C13H15P and a molecular weight of 202.24 g/mol. Its IUPAC name is methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane.
| Compound Name | methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane |
|---|---|
| PubChem CID | 163826949 |
| Molecular Formula | C13H15P |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | methylidene-[(2E,4E)-4-phenylhexa-2,4-dien-2-yl]phosphane |
| SMILES | C=P/C(C)=C/C(=C\C)c1ccccc1 |
| InChI | InChI=1S/C13H15P/c1-4-12(10-11(2)14-3)13-8-6-5-7-9-13/h4-10H,3H2,1-2H3/b11-10+,12-4+ |
| InChIKey | OAHJBGXFXQBHMH-QNKFPFBSSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|