C8H7FN2O2 — CID 118130146
(3Z,5E)-7-fluoro-2-methylidene-5-nitrohepta-3,5-dienenitrile (PubChem CID 118130146) has the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. Its IUPAC name is (3Z,5E)-7-fluoro-2-methylidene-5-nitrohepta-3,5-dienenitrile.
| Compound Name | (3Z,5E)-7-fluoro-2-methylidene-5-nitrohepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 118130146 |
| Molecular Formula | C8H7FN2O2 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | (3Z,5E)-7-fluoro-2-methylidene-5-nitrohepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C\C(=C/CF)[N+](=O)[O-] |
| InChI | InChI=1S/C8H7FN2O2/c1-7(6-10)2-3-8(4-5-9)11(12)13/h2-4H,1,5H2/b3-2-,8-4+ |
| InChIKey | MGXOTLVSYFZUTO-SOBRUKQLSA-N |
| XLogP | 1.75 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|