C8H10N2O2 — CID 145241046
(3E,5E)-5-nitroocta-1,3,5,7-tetraen-3-amine (PubChem CID 145241046) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (3E,5E)-5-nitroocta-1,3,5,7-tetraen-3-amine.
| Compound Name | (3E,5E)-5-nitroocta-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 145241046 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (3E,5E)-5-nitroocta-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C=C(\C=C(\N)C=C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O2/c1-3-5-8(10(11)12)6-7(9)4-2/h3-6H,1-2,9H2/b7-6+,8-5+ |
| InChIKey | OLPAMCCVAHJDTD-ZCOYIIAOSA-N |
| XLogP | 1.36 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|