C6H7N3O4 — CID 146204806
(1E,3E)-1,5-dinitrohexa-1,3,5-trien-3-amine (PubChem CID 146204806) has the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. Its IUPAC name is (1E,3E)-1,5-dinitrohexa-1,3,5-trien-3-amine.
| Compound Name | (1E,3E)-1,5-dinitrohexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 146204806 |
| Molecular Formula | C6H7N3O4 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | (1E,3E)-1,5-dinitrohexa-1,3,5-trien-3-amine |
| SMILES | C=C(/C=C(N)\C=C\[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H7N3O4/c1-5(9(12)13)4-6(7)2-3-8(10)11/h2-4H,1,7H2/b3-2+,6-4+ |
| InChIKey | GHDPHXGRUNVRBK-WJPDYIDTSA-N |
| XLogP | 0.41 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|