C6H6ClNO2 — CID 143594332
(3Z)-2-chloro-5-nitrohexa-1,3,5-triene (PubChem CID 143594332) has the molecular formula C6H6ClNO2 and a molecular weight of 159.57 g/mol. Its IUPAC name is (3Z)-2-chloro-5-nitrohexa-1,3,5-triene.
| Compound Name | (3Z)-2-chloro-5-nitrohexa-1,3,5-triene |
|---|---|
| PubChem CID | 143594332 |
| Molecular Formula | C6H6ClNO2 |
| Molecular Weight | 159.57 g/mol |
| Exact Mass | 159.01 |
| IUPAC Name | (3Z)-2-chloro-5-nitrohexa-1,3,5-triene |
| SMILES | C=C(Cl)/C=C\C(=C)[N+](=O)[O-] |
| InChI | InChI=1S/C6H6ClNO2/c1-5(7)3-4-6(2)8(9)10/h3-4H,1-2H2/b4-3- |
| InChIKey | MCUKJYGHEVRCOK-ARJAWSKDSA-N |
| XLogP | 2.09 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|