C11H9ClFN5O2 — CID 126499594
N'-[N-(3-fluoro-4-pyridinyl)-C-[(1E)-3-nitrobuta-1,3-dienyl]carbonimidoyl]carbamimidoyl chloride (PubChem CID 126499594) has the molecular formula C11H9ClFN5O2 and a molecular weight of 297.68 g/mol. Its IUPAC name is N'-[N-(3-fluoro-4-pyridinyl)-C-[(1E)-3-nitrobuta-1,3-dienyl]carbonimidoyl]carbamimidoyl chloride.
| Compound Name | N'-[N-(3-fluoro-4-pyridinyl)-C-[(1E)-3-nitrobuta-1,3-dienyl]carbonimidoyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 126499594 |
| Molecular Formula | C11H9ClFN5O2 |
| Molecular Weight | 297.68 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N'-[N-(3-fluoro-4-pyridinyl)-C-[(1E)-3-nitrobuta-1,3-dienyl]carbonimidoyl]carbamimidoyl chloride |
| SMILES | C=C(/C=C/C(/N=C(/N)Cl)=N/c1ccncc1F)[N+](=O)[O-] |
| InChI | InChI=1S/C11H9ClFN5O2/c1-7(18(19)20)2-3-10(17-11(12)14)16-9-4-5-15-6-8(9)13/h2-6H,1H2,(H2,14,15,16,17)/b3-2+ |
| InChIKey | QCGWTXDDXOTBDD-NSCUHMNNSA-N |
| XLogP | 2.15 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.68 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|