C10H7N3O3S — CID 143408391
(1Z,3E)-1-nitro-4-([1,3]oxazolo[4,5-c]pyridin-2-yl)buta-1,3-diene-1-thiol (PubChem CID 143408391) has the molecular formula C10H7N3O3S and a molecular weight of 249.25 g/mol. Its IUPAC name is (1Z,3E)-1-nitro-4-([1,3]oxazolo[4,5-c]pyridin-2-yl)buta-1,3-diene-1-thiol.
| Compound Name | (1Z,3E)-1-nitro-4-([1,3]oxazolo[4,5-c]pyridin-2-yl)buta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 143408391 |
| Molecular Formula | C10H7N3O3S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | (1Z,3E)-1-nitro-4-([1,3]oxazolo[4,5-c]pyridin-2-yl)buta-1,3-diene-1-thiol |
| SMILES | O=[N+]([O-])/C(S)=C/C=C/c1nc2cnccc2o1 |
| InChI | InChI=1S/C10H7N3O3S/c14-13(15)10(17)3-1-2-9-12-7-6-11-5-4-8(7)16-9/h1-6,17H/b2-1+,10-3- |
| InChIKey | REKXYWWFYSLBCB-BNHHILBFSA-N |
| XLogP | 2.28 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|