C12H13N3O2 — CID 177213869
[1,3]oxazolo[4,5-c]pyridin-2-yl(piperidin-1-yl)methanone (PubChem CID 177213869) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is [1,3]oxazolo[4,5-c]pyridin-2-yl(piperidin-1-yl)methanone.
| Compound Name | [1,3]oxazolo[4,5-c]pyridin-2-yl(piperidin-1-yl)methanone |
|---|---|
| PubChem CID | 177213869 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | [1,3]oxazolo[4,5-c]pyridin-2-yl(piperidin-1-yl)methanone |
| SMILES | O=C(c1nc2cnccc2o1)N1CCCCC1 |
| InChI | InChI=1S/C12H13N3O2/c16-12(15-6-2-1-3-7-15)11-14-9-8-13-5-4-10(9)17-11/h4-5,8H,1-3,6-7H2 |
| InChIKey | PIMFLMNEMWTNCT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |