C19H18N2O2 — CID 50849559
[4-(1,3-benzoxazol-2-yl)phenyl]-piperidin-1-ylmethanone (PubChem CID 50849559) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is [4-(1,3-benzoxazol-2-yl)phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-(1,3-benzoxazol-2-yl)phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 50849559 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [4-(1,3-benzoxazol-2-yl)phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(-c2nc3ccccc3o2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H18N2O2/c22-19(21-12-4-1-5-13-21)15-10-8-14(9-11-15)18-20-16-6-2-3-7-17(16)23-18/h2-3,6-11H,1,4-5,12-13H2 |
| InChIKey | WHYRAEGEUVLBCI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |