C15H17N3O2 — CID 8869673
azepan-1-yl-[4-(1,3,4-oxadiazol-2-yl)phenyl]methanone (PubChem CID 8869673) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is azepan-1-yl-[4-(1,3,4-oxadiazol-2-yl)phenyl]methanone.
| Compound Name | azepan-1-yl-[4-(1,3,4-oxadiazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 8869673 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | azepan-1-yl-[4-(1,3,4-oxadiazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2nnco2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C15H17N3O2/c19-15(18-9-3-1-2-4-10-18)13-7-5-12(6-8-13)14-17-16-11-20-14/h5-8,11H,1-4,9-10H2 |
| InChIKey | KIQBYGJTIHQXSS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |