C11H11N3O3 — CID 86008495
N,N-dimethyl-2-(5-nitro-1,3-benzoxazol-2-yl)ethenamine (PubChem CID 86008495) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-nitro-1,3-benzoxazol-2-yl)ethenamine.
| Compound Name | N,N-dimethyl-2-(5-nitro-1,3-benzoxazol-2-yl)ethenamine |
|---|---|
| PubChem CID | 86008495 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N,N-dimethyl-2-(5-nitro-1,3-benzoxazol-2-yl)ethenamine |
| SMILES | CN(C)C=Cc1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C11H11N3O3/c1-13(2)6-5-11-12-9-7-8(14(15)16)3-4-10(9)17-11/h3-7H,1-2H3 |
| InChIKey | ZFPRORZWMUCYAM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|