C17H14N2O3 — CID 8832260
2-[(E)-2-(2,4-dimethylphenyl)ethenyl]-5-nitro-1,3-benzoxazole (PubChem CID 8832260) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[(E)-2-(2,4-dimethylphenyl)ethenyl]-5-nitro-1,3-benzoxazole.
| Compound Name | 2-[(E)-2-(2,4-dimethylphenyl)ethenyl]-5-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 8832260 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(E)-2-(2,4-dimethylphenyl)ethenyl]-5-nitro-1,3-benzoxazole |
| SMILES | Cc1ccc(/C=C/c2nc3cc([N+](=O)[O-])ccc3o2)c(C)c1 |
| InChI | InChI=1S/C17H14N2O3/c1-11-3-4-13(12(2)9-11)5-8-17-18-15-10-14(19(20)21)6-7-16(15)22-17/h3-10H,1-2H3/b8-5+ |
| InChIKey | QNARYEALYCFJSK-VMPITWQZSA-N |
| XLogP | 4.52 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|