C13H7BrN2O3S — CID 8832291
2-[(E)-2-(4-bromothiophen-2-yl)ethenyl]-5-nitro-1,3-benzoxazole (PubChem CID 8832291) has the molecular formula C13H7BrN2O3S and a molecular weight of 351.18 g/mol. Its IUPAC name is 2-[(E)-2-(4-bromothiophen-2-yl)ethenyl]-5-nitro-1,3-benzoxazole.
| Compound Name | 2-[(E)-2-(4-bromothiophen-2-yl)ethenyl]-5-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 8832291 |
| Molecular Formula | C13H7BrN2O3S |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 2-[(E)-2-(4-bromothiophen-2-yl)ethenyl]-5-nitro-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1ccc2oc(/C=C/c3cc(Br)cs3)nc2c1 |
| InChI | InChI=1S/C13H7BrN2O3S/c14-8-5-10(20-7-8)2-4-13-15-11-6-9(16(17)18)1-3-12(11)19-13/h1-7H/b4-2+ |
| InChIKey | CPPVTPZCOMHQDI-DUXPYHPUSA-N |
| XLogP | 4.73 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|