C10H11N3O2S2 — CID 143408863
(1Z,3E)-5-[(3-amino-4-pyridinyl)sulfanyl]-1-nitropenta-1,3-diene-1-thiol (PubChem CID 143408863) has the molecular formula C10H11N3O2S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is (1Z,3E)-5-[(3-amino-4-pyridinyl)sulfanyl]-1-nitropenta-1,3-diene-1-thiol.
| Compound Name | (1Z,3E)-5-[(3-amino-4-pyridinyl)sulfanyl]-1-nitropenta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 143408863 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | (1Z,3E)-5-[(3-amino-4-pyridinyl)sulfanyl]-1-nitropenta-1,3-diene-1-thiol |
| SMILES | Nc1cnccc1SC/C=C/C=C(\S)[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N3O2S2/c11-8-7-12-5-4-9(8)17-6-2-1-3-10(16)13(14)15/h1-5,7,16H,6,11H2/b2-1+,10-3- |
| InChIKey | KDLXCEJXHBTIMC-BNHHILBFSA-N |
| XLogP | 2.36 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|