C8H11N3O2S — CID 65443798
2-amino-3-[(3-amino-4-pyridinyl)sulfanyl]propanoic acid (PubChem CID 65443798) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-amino-3-[(3-amino-4-pyridinyl)sulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[(3-amino-4-pyridinyl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 65443798 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-amino-3-[(3-amino-4-pyridinyl)sulfanyl]propanoic acid |
| SMILES | Nc1cnccc1SCC(N)C(=O)O |
| InChI | InChI=1S/C8H11N3O2S/c9-5-3-11-2-1-7(5)14-4-6(10)8(12)13/h1-3,6H,4,9-10H2,(H,12,13) |
| InChIKey | ZLMBJJSTUSXVOG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |