C10H14N2O2S — CID 79143906
2-amino-3-(3-amino-2-methylphenyl)sulfanylpropanoic acid (PubChem CID 79143906) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-amino-3-(3-amino-2-methylphenyl)sulfanylpropanoic acid.
| Compound Name | 2-amino-3-(3-amino-2-methylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 79143906 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-amino-3-(3-amino-2-methylphenyl)sulfanylpropanoic acid |
| SMILES | Cc1c(N)cccc1SCC(N)C(=O)O |
| InChI | InChI=1S/C10H14N2O2S/c1-6-7(11)3-2-4-9(6)15-5-8(12)10(13)14/h2-4,8H,5,11-12H2,1H3,(H,13,14) |
| InChIKey | WOQWDPIWRIGRTI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|