C9H13N3OS — CID 79140854
2-(3-amino-2-methylphenyl)sulfanylacetohydrazide (PubChem CID 79140854) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(3-amino-2-methylphenyl)sulfanylacetohydrazide.
| Compound Name | 2-(3-amino-2-methylphenyl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 79140854 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(3-amino-2-methylphenyl)sulfanylacetohydrazide |
| SMILES | Cc1c(N)cccc1SCC(=O)NN |
| InChI | InChI=1S/C9H13N3OS/c1-6-7(10)3-2-4-8(6)14-5-9(13)12-11/h2-4H,5,10-11H2,1H3,(H,12,13) |
| InChIKey | JSZCITKWVFXRAF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|