C8H10N2O5S2 — CID 175225846
2-amino-3-[(2-sulfo-3-pyridinyl)sulfanyl]propanoic acid (PubChem CID 175225846) has the molecular formula C8H10N2O5S2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-amino-3-[(2-sulfo-3-pyridinyl)sulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[(2-sulfo-3-pyridinyl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 175225846 |
| Molecular Formula | C8H10N2O5S2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 2-amino-3-[(2-sulfo-3-pyridinyl)sulfanyl]propanoic acid |
| SMILES | NC(CSc1cccnc1S(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10N2O5S2/c9-5(8(11)12)4-16-6-2-1-3-10-7(6)17(13,14)15/h1-3,5H,4,9H2,(H,11,12)(H,13,14,15) |
| InChIKey | JAHABOVDTBECAF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|