C14H14N2O2 — CID 145381534
2-ethenyl-1-[(3E,5Z)-7-nitroocta-1,3,5,7-tetraen-4-yl]pyrrole (PubChem CID 145381534) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-ethenyl-1-[(3E,5Z)-7-nitroocta-1,3,5,7-tetraen-4-yl]pyrrole.
| Compound Name | 2-ethenyl-1-[(3E,5Z)-7-nitroocta-1,3,5,7-tetraen-4-yl]pyrrole |
|---|---|
| PubChem CID | 145381534 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-ethenyl-1-[(3E,5Z)-7-nitroocta-1,3,5,7-tetraen-4-yl]pyrrole |
| SMILES | C=C/C=C(\C=C/C(=C)[N+](=O)[O-])n1cccc1C=C |
| InChI | InChI=1S/C14H14N2O2/c1-4-7-14(10-9-12(3)16(17)18)15-11-6-8-13(15)5-2/h4-11H,1-3H2/b10-9-,14-7+ |
| InChIKey | OHTZLVDXFQCNAF-YNGKKNEWSA-N |
| XLogP | 3.50 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|