C8H10N2O4 — CID 142185753
(3Z,5E)-3-methyl-5,7-dinitrohepta-1,3,5-triene (PubChem CID 142185753) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is (3Z,5E)-3-methyl-5,7-dinitrohepta-1,3,5-triene.
| Compound Name | (3Z,5E)-3-methyl-5,7-dinitrohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142185753 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (3Z,5E)-3-methyl-5,7-dinitrohepta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C(=C/C[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O4/c1-3-7(2)6-8(10(13)14)4-5-9(11)12/h3-4,6H,1,5H2,2H3/b7-6-,8-4+ |
| InChIKey | OMZVSVGLQVVXCP-AKAREZBESA-N |
| XLogP | 1.56 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|