C7H10NO2+ — CID 135012788
3-ethyl-5-nitropenta-1,3-diene (PubChem CID 135012788) has the molecular formula C7H10NO2+ and a molecular weight of 140.16 g/mol. Its IUPAC name is 3-ethyl-5-nitropenta-1,3-diene.
| Compound Name | 3-ethyl-5-nitropenta-1,3-diene |
|---|---|
| PubChem CID | 135012788 |
| Molecular Formula | C7H10NO2+ |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 3-ethyl-5-nitropenta-1,3-diene |
| SMILES | C=CC(=CC[N+](=O)[O-])C[CH2+] |
| InChI | InChI=1S/C7H10NO2/c1-3-7(4-2)5-6-8(9)10/h3,5H,1-2,4,6H2/q+1 |
| InChIKey | FJFAYXODFIWVHF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|